C25H25N3O4S — CID 37311265
N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-(methanesulfonamido)benzamide (PubChem CID 37311265) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-(methanesulfonamido)benzamide.
| Compound Name | N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 37311265 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-(methanesulfonamido)benzamide |
| SMILES | COc1ccc([C@H](CNC(=O)c2cccc(NS(C)(=O)=O)c2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H25N3O4S/c1-32-20-12-10-17(11-13-20)22(23-16-26-24-9-4-3-8-21(23)24)15-27-25(29)18-6-5-7-19(14-18)28-33(2,30)31/h3-14,16,22,26,28H,15H2,1-2H3,(H,27,29)/t22-/m0/s1 |
| InChIKey | IEHJIJKTJAUFHR-QFIPXVFZSA-N |
| XLogP | 4.11 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |