C25H27N7 — CID 133424819
N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133424819) has the molecular formula C25H27N7 and a molecular weight of 425.54 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133424819 |
| Molecular Formula | C25H27N7 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CCc1nnc2ccc(NCC(c3ccc(N(C)C)cc3)c3c[nH]c4ccccc34)nn12 |
| InChI | InChI=1S/C25H27N7/c1-4-24-28-29-25-14-13-23(30-32(24)25)27-15-20(17-9-11-18(12-10-17)31(2)3)21-16-26-22-8-6-5-7-19(21)22/h5-14,16,20,26H,4,15H2,1-3H3,(H,27,30) |
| InChIKey | YZDMRELUCGYSJO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|