C17H19N2O+ — CID 7061229
[(2S)-2-(1H-indol-3-yl)-2-(2-methoxyphenyl)ethyl]azanium (PubChem CID 7061229) has the molecular formula C17H19N2O+ and a molecular weight of 267.35 g/mol. Its IUPAC name is [(2S)-2-(1H-indol-3-yl)-2-(2-methoxyphenyl)ethyl]azanium.
| Compound Name | [(2S)-2-(1H-indol-3-yl)-2-(2-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 7061229 |
| Molecular Formula | C17H19N2O+ |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | [(2S)-2-(1H-indol-3-yl)-2-(2-methoxyphenyl)ethyl]azanium |
| SMILES | COc1ccccc1[C@@H](C[NH3+])c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H18N2O/c1-20-17-9-5-3-7-13(17)14(10-18)15-11-19-16-8-4-2-6-12(15)16/h2-9,11,14,19H,10,18H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | WNFPDZUJNUFUCL-CQSZACIVSA-O |
| XLogP | 2.55 |
| TPSA | 52.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |