C19H20N2O5 — CID 24764118
3-[2-nitro-1-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole (PubChem CID 24764118) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-[2-nitro-1-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole.
| Compound Name | 3-[2-nitro-1-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole |
|---|---|
| PubChem CID | 24764118 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-[2-nitro-1-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole |
| SMILES | COc1cc(C(C[N+](=O)[O-])c2c[nH]c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O5/c1-24-17-8-12(9-18(25-2)19(17)26-3)15(11-21(22)23)14-10-20-16-7-5-4-6-13(14)16/h4-10,15,20H,11H2,1-3H3 |
| InChIKey | MMCCLQKHDDEIHG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|