C23H21N5S — CID 167913134
2-(1H-indol-3-yl)-N-[(3-pyridin-2-yl-1H-pyrazol-5-yl)methyl]-2-thiophen-2-ylethanamine (PubChem CID 167913134) has the molecular formula C23H21N5S and a molecular weight of 399.52 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[(3-pyridin-2-yl-1H-pyrazol-5-yl)methyl]-2-thiophen-2-ylethanamine.
| Compound Name | 2-(1H-indol-3-yl)-N-[(3-pyridin-2-yl-1H-pyrazol-5-yl)methyl]-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 167913134 |
| Molecular Formula | C23H21N5S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[(3-pyridin-2-yl-1H-pyrazol-5-yl)methyl]-2-thiophen-2-ylethanamine |
| SMILES | c1ccc(-c2cc(CNCC(c3cccs3)c3c[nH]c4ccccc34)[nH]n2)nc1 |
| InChI | InChI=1S/C23H21N5S/c1-2-7-20-17(6-1)18(15-26-20)19(23-9-5-11-29-23)14-24-13-16-12-22(28-27-16)21-8-3-4-10-25-21/h1-12,15,19,24,26H,13-14H2,(H,27,28) |
| InChIKey | NQONXELPJSMGDG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |