C26H19BrN2O3 — CID 35127246
N-[(2S)-2-(4-bromophenyl)-2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 35127246) has the molecular formula C26H19BrN2O3 and a molecular weight of 487.35 g/mol. Its IUPAC name is N-[(2S)-2-(4-bromophenyl)-2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(2S)-2-(4-bromophenyl)-2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 35127246 |
| Molecular Formula | C26H19BrN2O3 |
| Molecular Weight | 487.35 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | N-[(2S)-2-(4-bromophenyl)-2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NC[C@@H](c1ccc(Br)cc1)c1c[nH]c2ccccc12)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C26H19BrN2O3/c27-18-11-9-16(10-12-18)21(22-15-28-23-7-3-2-6-19(22)23)14-29-25(30)20-13-17-5-1-4-8-24(17)32-26(20)31/h1-13,15,21,28H,14H2,(H,29,30)/t21-/m0/s1 |
| InChIKey | IDUUZKIYTSSVFU-NRFANRHFSA-N |
| XLogP | 5.60 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.35 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|