C20H18N4OS — CID 113013820
N-[6-[2-(1H-indol-3-yl)ethylamino]-3-pyridinyl]thiophene-2-carboxamide (PubChem CID 113013820) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is N-[6-[2-(1H-indol-3-yl)ethylamino]-3-pyridinyl]thiophene-2-carboxamide.
| Compound Name | N-[6-[2-(1H-indol-3-yl)ethylamino]-3-pyridinyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113013820 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[6-[2-(1H-indol-3-yl)ethylamino]-3-pyridinyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(NCCc2c[nH]c3ccccc23)nc1)c1cccs1 |
| InChI | InChI=1S/C20H18N4OS/c25-20(18-6-3-11-26-18)24-15-7-8-19(23-13-15)21-10-9-14-12-22-17-5-2-1-4-16(14)17/h1-8,11-13,22H,9-10H2,(H,21,23)(H,24,25) |
| InChIKey | WDPJBVLNTXYUSL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |