C22H18F2N4O — CID 113028912
3,4-difluoro-N-[5-[2-(1H-indol-3-yl)ethylamino]-2-pyridinyl]benzamide (PubChem CID 113028912) has the molecular formula C22H18F2N4O and a molecular weight of 392.41 g/mol. Its IUPAC name is 3,4-difluoro-N-[5-[2-(1H-indol-3-yl)ethylamino]-2-pyridinyl]benzamide.
| Compound Name | 3,4-difluoro-N-[5-[2-(1H-indol-3-yl)ethylamino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113028912 |
| Molecular Formula | C22H18F2N4O |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3,4-difluoro-N-[5-[2-(1H-indol-3-yl)ethylamino]-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(NCCc2c[nH]c3ccccc23)cn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H18F2N4O/c23-18-7-5-14(11-19(18)24)22(29)28-21-8-6-16(13-27-21)25-10-9-15-12-26-20-4-2-1-3-17(15)20/h1-8,11-13,25-26H,9-10H2,(H,27,28,29) |
| InChIKey | UAIJSNJBCNMROC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |