C20H24N4O — CID 109159691
N,N-diethyl-6-[2-(1H-indol-3-yl)ethylamino]pyridine-3-carboxamide (PubChem CID 109159691) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is N,N-diethyl-6-[2-(1H-indol-3-yl)ethylamino]pyridine-3-carboxamide.
| Compound Name | N,N-diethyl-6-[2-(1H-indol-3-yl)ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109159691 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N,N-diethyl-6-[2-(1H-indol-3-yl)ethylamino]pyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NCCc2c[nH]c3ccccc23)nc1 |
| InChI | InChI=1S/C20H24N4O/c1-3-24(4-2)20(25)16-9-10-19(23-14-16)21-12-11-15-13-22-18-8-6-5-7-17(15)18/h5-10,13-14,22H,3-4,11-12H2,1-2H3,(H,21,23) |
| InChIKey | WGXAEFHAWYCZHU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |