C21H20N4O2 — CID 109155396
N-(furan-2-ylmethyl)-6-[2-(1H-indol-3-yl)ethylamino]pyridine-3-carboxamide (PubChem CID 109155396) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-6-[2-(1H-indol-3-yl)ethylamino]pyridine-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-6-[2-(1H-indol-3-yl)ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109155396 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-6-[2-(1H-indol-3-yl)ethylamino]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc(NCCc2c[nH]c3ccccc23)nc1 |
| InChI | InChI=1S/C21H20N4O2/c26-21(25-14-17-4-3-11-27-17)16-7-8-20(24-13-16)22-10-9-15-12-23-19-6-2-1-5-18(15)19/h1-8,11-13,23H,9-10,14H2,(H,22,24)(H,25,26) |
| InChIKey | UGGJBBXOFIJXFQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |