C23H19N5O — CID 109159767
6-(2-cyanoanilino)-N-[2-(1H-indol-3-yl)ethyl]pyridine-3-carboxamide (PubChem CID 109159767) has the molecular formula C23H19N5O and a molecular weight of 381.44 g/mol. Its IUPAC name is 6-(2-cyanoanilino)-N-[2-(1H-indol-3-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-(2-cyanoanilino)-N-[2-(1H-indol-3-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109159767 |
| Molecular Formula | C23H19N5O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 6-(2-cyanoanilino)-N-[2-(1H-indol-3-yl)ethyl]pyridine-3-carboxamide |
| SMILES | N#Cc1ccccc1Nc1ccc(C(=O)NCCc2c[nH]c3ccccc23)cn1 |
| InChI | InChI=1S/C23H19N5O/c24-13-16-5-1-3-7-20(16)28-22-10-9-18(15-27-22)23(29)25-12-11-17-14-26-21-8-4-2-6-19(17)21/h1-10,14-15,26H,11-12H2,(H,25,29)(H,27,28) |
| InChIKey | MJGUAFNQEOYGLL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |