C22H21N5O — CID 109261239
N-[2-(1H-indol-3-yl)ethyl]-2-(2-methylanilino)pyrimidine-5-carboxamide (PubChem CID 109261239) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2-(2-methylanilino)pyrimidine-5-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2-(2-methylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109261239 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2-(2-methylanilino)pyrimidine-5-carboxamide |
| SMILES | Cc1ccccc1Nc1ncc(C(=O)NCCc2c[nH]c3ccccc23)cn1 |
| InChI | InChI=1S/C22H21N5O/c1-15-6-2-4-8-19(15)27-22-25-13-17(14-26-22)21(28)23-11-10-16-12-24-20-9-5-3-7-18(16)20/h2-9,12-14,24H,10-11H2,1H3,(H,23,28)(H,25,26,27) |
| InChIKey | SHGXMPSVEOCITQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |