C25H26N4O — CID 109171507
N-benzyl-N-ethyl-2-[2-(1H-indol-3-yl)ethylamino]pyridine-4-carboxamide (PubChem CID 109171507) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[2-(1H-indol-3-yl)ethylamino]pyridine-4-carboxamide.
| Compound Name | N-benzyl-N-ethyl-2-[2-(1H-indol-3-yl)ethylamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109171507 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | N-benzyl-N-ethyl-2-[2-(1H-indol-3-yl)ethylamino]pyridine-4-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1ccnc(NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C25H26N4O/c1-2-29(18-19-8-4-3-5-9-19)25(30)20-12-14-26-24(16-20)27-15-13-21-17-28-23-11-7-6-10-22(21)23/h3-12,14,16-17,28H,2,13,15,18H2,1H3,(H,26,27) |
| InChIKey | CORQYMRPIBIHJK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |