C28H28N4O — CID 11517741
N,N-diethyl-9-[2-(1H-indol-3-yl)ethylamino]acridine-3-carboxamide (PubChem CID 11517741) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is N,N-diethyl-9-[2-(1H-indol-3-yl)ethylamino]acridine-3-carboxamide.
| Compound Name | N,N-diethyl-9-[2-(1H-indol-3-yl)ethylamino]acridine-3-carboxamide |
|---|---|
| PubChem CID | 11517741 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N,N-diethyl-9-[2-(1H-indol-3-yl)ethylamino]acridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(NCCc3c[nH]c4ccccc34)c3ccccc3nc2c1 |
| InChI | InChI=1S/C28H28N4O/c1-3-32(4-2)28(33)19-13-14-23-26(17-19)31-25-12-8-6-10-22(25)27(23)29-16-15-20-18-30-24-11-7-5-9-21(20)24/h5-14,17-18,30H,3-4,15-16H2,1-2H3,(H,29,31) |
| InChIKey | AQOIQRMMKJHQDJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|