C28H30FN5O3 — CID 12006004
N'-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide (PubChem CID 12006004) has the molecular formula C28H30FN5O3 and a molecular weight of 503.58 g/mol. Its IUPAC name is N'-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide.
| Compound Name | N'-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 12006004 |
| Molecular Formula | C28H30FN5O3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | N'-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C(=O)NCC(c1ccco1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H30FN5O3/c29-21-7-9-22(10-8-21)33-13-15-34(16-14-33)25(26-6-3-17-37-26)19-32-28(36)27(35)30-12-11-20-18-31-24-5-2-1-4-23(20)24/h1-10,17-18,25,31H,11-16,19H2,(H,30,35)(H,32,36) |
| InChIKey | LCHUDMHVPFINHM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|