C27H31FN4O4 — CID 41234286
N'-[(2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-[2-(2-methoxyphenyl)ethyl]oxamide (PubChem CID 41234286) has the molecular formula C27H31FN4O4 and a molecular weight of 494.57 g/mol. Its IUPAC name is N'-[(2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-[2-(2-methoxyphenyl)ethyl]oxamide.
| Compound Name | N'-[(2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-[2-(2-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 41234286 |
| Molecular Formula | C27H31FN4O4 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | N'-[(2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-[2-(2-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccccc1CCNC(=O)C(=O)NC[C@H](c1ccco1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H31FN4O4/c1-35-24-6-3-2-5-20(24)12-13-29-26(33)27(34)30-19-23(25-7-4-18-36-25)32-16-14-31(15-17-32)22-10-8-21(28)9-11-22/h2-11,18,23H,12-17,19H2,1H3,(H,29,33)(H,30,34)/t23-/m1/s1 |
| InChIKey | XKOLOAZMIADEQP-HSZRJFAPSA-N |
| XLogP | 2.77 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|