C27H31FN4O3 — CID 41234280
N'-[(2S)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-(3-phenylpropyl)oxamide (PubChem CID 41234280) has the molecular formula C27H31FN4O3 and a molecular weight of 478.57 g/mol. Its IUPAC name is N'-[(2S)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-(3-phenylpropyl)oxamide.
| Compound Name | N'-[(2S)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-(3-phenylpropyl)oxamide |
|---|---|
| PubChem CID | 41234280 |
| Molecular Formula | C27H31FN4O3 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N'-[(2S)-2-[4-(4-fluorophenyl)piperazin-1-yl]-2-(furan-2-yl)ethyl]-N-(3-phenylpropyl)oxamide |
| SMILES | O=C(NCCCc1ccccc1)C(=O)NC[C@@H](c1ccco1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H31FN4O3/c28-22-10-12-23(13-11-22)31-15-17-32(18-16-31)24(25-9-5-19-35-25)20-30-27(34)26(33)29-14-4-8-21-6-2-1-3-7-21/h1-3,5-7,9-13,19,24H,4,8,14-18,20H2,(H,29,33)(H,30,34)/t24-/m0/s1 |
| InChIKey | MUMXFKNUIHRPHP-DEOSSOPVSA-N |
| XLogP | 3.15 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|