C16H21N3O5S2 — CID 22584641
N-[2-(dimethylamino)ethyl]-N'-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]oxamide (PubChem CID 22584641) has the molecular formula C16H21N3O5S2 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]oxamide |
|---|---|
| PubChem CID | 22584641 |
| Molecular Formula | C16H21N3O5S2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]oxamide |
| SMILES | CN(C)CCNC(=O)C(=O)NCC(c1ccco1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H21N3O5S2/c1-19(2)8-7-17-15(20)16(21)18-11-13(12-5-3-9-24-12)26(22,23)14-6-4-10-25-14/h3-6,9-10,13H,7-8,11H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | FGURUDBXPLLHRL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|