C17H16N2O5S3 — CID 27555177
N-(furan-2-ylmethyl)-N'-[(2S)-2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl]oxamide (PubChem CID 27555177) has the molecular formula C17H16N2O5S3 and a molecular weight of 424.53 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[(2S)-2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl]oxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-[(2S)-2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl]oxamide |
|---|---|
| PubChem CID | 27555177 |
| Molecular Formula | C17H16N2O5S3 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[(2S)-2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl]oxamide |
| SMILES | O=C(NCc1ccco1)C(=O)NC[C@@H](c1cccs1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H16N2O5S3/c20-16(18-10-12-4-1-7-24-12)17(21)19-11-14(13-5-2-8-25-13)27(22,23)15-6-3-9-26-15/h1-9,14H,10-11H2,(H,18,20)(H,19,21)/t14-/m0/s1 |
| InChIKey | XXEZIVDQRYLLMQ-AWEZNQCLSA-N |
| XLogP | 2.35 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|