C18H17N3O5S2 — CID 27569543
N'-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-(pyridin-2-ylmethyl)oxamide (PubChem CID 27569543) has the molecular formula C18H17N3O5S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is N'-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-(pyridin-2-ylmethyl)oxamide.
| Compound Name | N'-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 27569543 |
| Molecular Formula | C18H17N3O5S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N'-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-(pyridin-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1ccccn1)C(=O)NC[C@@H](c1ccco1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H17N3O5S2/c22-17(20-11-13-5-1-2-8-19-13)18(23)21-12-15(14-6-3-9-26-14)28(24,25)16-7-4-10-27-16/h1-10,15H,11-12H2,(H,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | GIRWJVOSDGPVAC-HNNXBMFYSA-N |
| XLogP | 1.68 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|