C24H23N3O5S — CID 22584453
N'-[2-(benzenesulfonyl)-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide (PubChem CID 22584453) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is N'-[2-(benzenesulfonyl)-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide.
| Compound Name | N'-[2-(benzenesulfonyl)-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 22584453 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N'-[2-(benzenesulfonyl)-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C(=O)NCC(c1ccco1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O5S/c28-23(25-13-12-17-15-26-20-10-5-4-9-19(17)20)24(29)27-16-22(21-11-6-14-32-21)33(30,31)18-7-2-1-3-8-18/h1-11,14-15,22,26H,12-13,16H2,(H,25,28)(H,27,29) |
| InChIKey | DUYJEWGBDLOVBD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|