C15H17NO6S2 — CID 45468993
3-(3,4-dimethoxyphenyl)-3-(thiophen-2-ylsulfonylamino)propanoic acid (PubChem CID 45468993) has the molecular formula C15H17NO6S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-3-(thiophen-2-ylsulfonylamino)propanoic acid.
| Compound Name | 3-(3,4-dimethoxyphenyl)-3-(thiophen-2-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 45468993 |
| Molecular Formula | C15H17NO6S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-3-(thiophen-2-ylsulfonylamino)propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)NS(=O)(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C15H17NO6S2/c1-21-12-6-5-10(8-13(12)22-2)11(9-14(17)18)16-24(19,20)15-4-3-7-23-15/h3-8,11,16H,9H2,1-2H3,(H,17,18) |
| InChIKey | WFPYVPVVFGVRRC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |