C10H15NO4S2 — CID 61173993
(2S)-3-methyl-2-(thiophen-2-ylsulfonylamino)pentanoic acid (PubChem CID 61173993) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (2S)-3-methyl-2-(thiophen-2-ylsulfonylamino)pentanoic acid.
| Compound Name | (2S)-3-methyl-2-(thiophen-2-ylsulfonylamino)pentanoic acid |
|---|---|
| PubChem CID | 61173993 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (2S)-3-methyl-2-(thiophen-2-ylsulfonylamino)pentanoic acid |
| SMILES | CCC(C)[C@H](NS(=O)(=O)c1cccs1)C(=O)O |
| InChI | InChI=1S/C10H15NO4S2/c1-3-7(2)9(10(12)13)11-17(14,15)8-5-4-6-16-8/h4-7,9,11H,3H2,1-2H3,(H,12,13)/t7?,9-/m0/s1 |
| InChIKey | BTEYGZQXOOESPM-NETXQHHPSA-N |
| XLogP | 1.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |