C10H16N2O3S2 — CID 95567579
(2R,3S)-3-methyl-2-(thiophen-2-ylsulfonylamino)pentanamide (PubChem CID 95567579) has the molecular formula C10H16N2O3S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2R,3S)-3-methyl-2-(thiophen-2-ylsulfonylamino)pentanamide.
| Compound Name | (2R,3S)-3-methyl-2-(thiophen-2-ylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 95567579 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (2R,3S)-3-methyl-2-(thiophen-2-ylsulfonylamino)pentanamide |
| SMILES | CC[C@H](C)[C@@H](NS(=O)(=O)c1cccs1)C(N)=O |
| InChI | InChI=1S/C10H16N2O3S2/c1-3-7(2)9(10(11)13)12-17(14,15)8-5-4-6-16-8/h4-7,9,12H,3H2,1-2H3,(H2,11,13)/t7-,9+/m0/s1 |
| InChIKey | ONLZRCBQKAXANO-IONNQARKSA-N |
| XLogP | 0.93 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |