C16H26N2O5S2 — CID 7977386
[2-oxo-2-(pentan-3-ylamino)ethyl] (2R)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanoate (PubChem CID 7977386) has the molecular formula C16H26N2O5S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is [2-oxo-2-(pentan-3-ylamino)ethyl] (2R)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanoate.
| Compound Name | [2-oxo-2-(pentan-3-ylamino)ethyl] (2R)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 7977386 |
| Molecular Formula | C16H26N2O5S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [2-oxo-2-(pentan-3-ylamino)ethyl] (2R)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanoate |
| SMILES | CCC(CC)NC(=O)COC(=O)[C@H](NS(=O)(=O)c1cccs1)C(C)C |
| InChI | InChI=1S/C16H26N2O5S2/c1-5-12(6-2)17-13(19)10-23-16(20)15(11(3)4)18-25(21,22)14-8-7-9-24-14/h7-9,11-12,15,18H,5-6,10H2,1-4H3,(H,17,19)/t15-/m1/s1 |
| InChIKey | RJXYGQUZSYLVBD-OAHLLOKOSA-N |
| XLogP | 1.90 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |