C16H23FN2O5S — CID 8849451
[2-oxo-2-(pentan-3-ylamino)ethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate (PubChem CID 8849451) has the molecular formula C16H23FN2O5S and a molecular weight of 374.43 g/mol. Its IUPAC name is [2-oxo-2-(pentan-3-ylamino)ethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-oxo-2-(pentan-3-ylamino)ethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8849451 |
| Molecular Formula | C16H23FN2O5S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [2-oxo-2-(pentan-3-ylamino)ethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate |
| SMILES | CCC(CC)NC(=O)COC(=O)[C@H](C)NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C16H23FN2O5S/c1-4-12(5-2)18-15(20)10-24-16(21)11(3)19-25(22,23)14-9-7-6-8-13(14)17/h6-9,11-12,19H,4-5,10H2,1-3H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | AKXAPAYKNTWRMR-NSHDSACASA-N |
| XLogP | 1.34 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |