C19H20FNO6S — CID 8849505
[2-(4-ethoxyphenyl)-2-oxoethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate (PubChem CID 8849505) has the molecular formula C19H20FNO6S and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8849505 |
| Molecular Formula | C19H20FNO6S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)[C@H](C)NS(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C19H20FNO6S/c1-3-26-15-10-8-14(9-11-15)17(22)12-27-19(23)13(2)21-28(24,25)18-7-5-4-6-16(18)20/h4-11,13,21H,3,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | FDRPCYNXMKAOFH-ZDUSSCGKSA-N |
| XLogP | 2.32 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |