C16H22FNO4S — CID 25499350
cyclohexylmethyl (2R)-2-[(2-fluorophenyl)sulfonylamino]propanoate (PubChem CID 25499350) has the molecular formula C16H22FNO4S and a molecular weight of 343.42 g/mol. Its IUPAC name is cyclohexylmethyl (2R)-2-[(2-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | cyclohexylmethyl (2R)-2-[(2-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 25499350 |
| Molecular Formula | C16H22FNO4S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | cyclohexylmethyl (2R)-2-[(2-fluorophenyl)sulfonylamino]propanoate |
| SMILES | C[C@@H](NS(=O)(=O)c1ccccc1F)C(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C16H22FNO4S/c1-12(16(19)22-11-13-7-3-2-4-8-13)18-23(20,21)15-10-6-5-9-14(15)17/h5-6,9-10,12-13,18H,2-4,7-8,11H2,1H3/t12-/m1/s1 |
| InChIKey | SXVXJGNTTRDUSY-GFCCVEGCSA-N |
| XLogP | 2.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |