C19H30FN3O3S — CID 119589001
N-(2-amino-1-cyclohexylethyl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 119589001) has the molecular formula C19H30FN3O3S and a molecular weight of 399.53 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 119589001 |
| Molecular Formula | C19H30FN3O3S |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1F)C(=O)NC(CN)C1CCCCC1 |
| InChI | InChI=1S/C19H30FN3O3S/c1-13(2)18(23-27(25,26)17-11-7-6-10-15(17)20)19(24)22-16(12-21)14-8-4-3-5-9-14/h6-7,10-11,13-14,16,18,23H,3-5,8-9,12,21H2,1-2H3,(H,22,24) |
| InChIKey | CFMQBVZFETYZBF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |