C18H29N3O2S — CID 119591130
N-[1-[(2-amino-1-cyclohexylethyl)amino]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide (PubChem CID 119591130) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is N-[1-[(2-amino-1-cyclohexylethyl)amino]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[(2-amino-1-cyclohexylethyl)amino]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119591130 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-[1-[(2-amino-1-cyclohexylethyl)amino]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(C)C(NC(=O)c1cccs1)C(=O)NC(CN)C1CCCCC1 |
| InChI | InChI=1S/C18H29N3O2S/c1-12(2)16(21-17(22)15-9-6-10-24-15)18(23)20-14(11-19)13-7-4-3-5-8-13/h6,9-10,12-14,16H,3-5,7-8,11,19H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | PRNXZMSDFYBAHX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |