C20H26ClN3O2S — CID 119591586
N-[3-[(2-amino-1-cyclohexylethyl)carbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 119591586) has the molecular formula C20H26ClN3O2S and a molecular weight of 407.97 g/mol. Its IUPAC name is N-[3-[(2-amino-1-cyclohexylethyl)carbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[(2-amino-1-cyclohexylethyl)carbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119591586 |
| Molecular Formula | C20H26ClN3O2S |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[3-[(2-amino-1-cyclohexylethyl)carbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)c1cccc(NC(=O)c2cccs2)c1)C1CCCCC1 |
| InChI | InChI=1S/C20H25N3O2S.ClH/c21-13-17(14-6-2-1-3-7-14)23-19(24)15-8-4-9-16(12-15)22-20(25)18-10-5-11-26-18;/h4-5,8-12,14,17H,1-3,6-7,13,21H2,(H,22,25)(H,23,24);1H |
| InChIKey | LUQBMKXBDGPSPX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |