C15H23FN2O4S — CID 18160979
(2S)-2-[(2-fluorophenyl)sulfonylamino]-N-(1-methoxypropan-2-yl)-3-methylbutanamide (PubChem CID 18160979) has the molecular formula C15H23FN2O4S and a molecular weight of 346.42 g/mol. Its IUPAC name is (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-(1-methoxypropan-2-yl)-3-methylbutanamide.
| Compound Name | (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-(1-methoxypropan-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 18160979 |
| Molecular Formula | C15H23FN2O4S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-(1-methoxypropan-2-yl)-3-methylbutanamide |
| SMILES | COCC(C)NC(=O)[C@@H](NS(=O)(=O)c1ccccc1F)C(C)C |
| InChI | InChI=1S/C15H23FN2O4S/c1-10(2)14(15(19)17-11(3)9-22-4)18-23(20,21)13-8-6-5-7-12(13)16/h5-8,10-11,14,18H,9H2,1-4H3,(H,17,19)/t11?,14-/m0/s1 |
| InChIKey | ONWCCNYOTQQCJG-IAXJKZSUSA-N |
| XLogP | 1.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |