C20H26FN3O5S — CID 55939456
(2S)-2-[(2-fluorophenyl)sulfonylamino]-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutanamide (PubChem CID 55939456) has the molecular formula C20H26FN3O5S and a molecular weight of 439.51 g/mol. Its IUPAC name is (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutanamide.
| Compound Name | (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 55939456 |
| Molecular Formula | C20H26FN3O5S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutanamide |
| SMILES | COCCOc1ccc(CNC(=O)[C@@H](NS(=O)(=O)c2ccccc2F)C(C)C)cn1 |
| InChI | InChI=1S/C20H26FN3O5S/c1-14(2)19(24-30(26,27)17-7-5-4-6-16(17)21)20(25)23-13-15-8-9-18(22-12-15)29-11-10-28-3/h4-9,12,14,19,24H,10-11,13H2,1-3H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | JJCVCURFYKZNAC-IBGZPJMESA-N |
| XLogP | 1.87 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|