C18H23N3O3S — CID 110348930
(2S)-3-methyl-2-[(2-methylphenyl)sulfonylamino]-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 110348930) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(2-methylphenyl)sulfonylamino]-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | (2S)-3-methyl-2-[(2-methylphenyl)sulfonylamino]-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 110348930 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (2S)-3-methyl-2-[(2-methylphenyl)sulfonylamino]-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | Cc1ccccc1S(=O)(=O)N[C@H](C(=O)NCc1cccnc1)C(C)C |
| InChI | InChI=1S/C18H23N3O3S/c1-13(2)17(18(22)20-12-15-8-6-10-19-11-15)21-25(23,24)16-9-5-4-7-14(16)3/h4-11,13,17,21H,12H2,1-3H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | LTAUGJILYJOXHZ-KRWDZBQOSA-N |
| XLogP | 2.01 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |