C13H22N4O3S — CID 110348899
(2S)-2-(dimethylsulfamoylamino)-3-methyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 110348899) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is (2S)-2-(dimethylsulfamoylamino)-3-methyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | (2S)-2-(dimethylsulfamoylamino)-3-methyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 110348899 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2S)-2-(dimethylsulfamoylamino)-3-methyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)N(C)C)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C13H22N4O3S/c1-10(2)12(16-21(19,20)17(3)4)13(18)15-9-11-6-5-7-14-8-11/h5-8,10,12,16H,9H2,1-4H3,(H,15,18)/t12-/m0/s1 |
| InChIKey | XJZIDVPTAOCFOB-LBPRGKRZSA-N |
| XLogP | 0.12 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |