C18H21ClN4O2 — CID 110348871
(2S)-2-[(4-chlorophenyl)carbamoylamino]-3-methyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 110348871) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)carbamoylamino]-3-methyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | (2S)-2-[(4-chlorophenyl)carbamoylamino]-3-methyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 110348871 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)carbamoylamino]-3-methyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccc(Cl)cc1)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-12(2)16(17(24)21-11-13-4-3-9-20-10-13)23-18(25)22-15-7-5-14(19)6-8-15/h3-10,12,16H,11H2,1-2H3,(H,21,24)(H2,22,23,25)/t16-/m0/s1 |
| InChIKey | ZVLXKBNNPCOLFN-INIZCTEOSA-N |
| XLogP | 3.20 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |