C21H21ClN4O3S — CID 66611091
1-[4-[(4-chlorophenyl)methyl-methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 66611091) has the molecular formula C21H21ClN4O3S and a molecular weight of 444.94 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methyl-methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[(4-chlorophenyl)methyl-methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 66611091 |
| Molecular Formula | C21H21ClN4O3S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methyl-methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CN(Cc1ccc(Cl)cc1)S(=O)(=O)c1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C21H21ClN4O3S/c1-26(15-16-4-6-18(22)7-5-16)30(28,29)20-10-8-19(9-11-20)25-21(27)24-14-17-3-2-12-23-13-17/h2-13H,14-15H2,1H3,(H2,24,25,27) |
| InChIKey | IDRBMAGVRBWSKV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |