C21H27FN4O3S — CID 140618972
1-[4-[(3-fluorocyclohexyl)methyl-methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 140618972) has the molecular formula C21H27FN4O3S and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-[4-[(3-fluorocyclohexyl)methyl-methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[(3-fluorocyclohexyl)methyl-methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 140618972 |
| Molecular Formula | C21H27FN4O3S |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-[4-[(3-fluorocyclohexyl)methyl-methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CN(CC1CCCC(F)C1)S(=O)(=O)c1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C21H27FN4O3S/c1-26(15-16-4-2-6-18(22)12-16)30(28,29)20-9-7-19(8-10-20)25-21(27)24-14-17-5-3-11-23-13-17/h3,5,7-11,13,16,18H,2,4,6,12,14-15H2,1H3,(H2,24,25,27) |
| InChIKey | LWZUHEOGKLSLRY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |