C22H32N4O4S — CID 138750902
1-[4-[3-propoxypropyl(propyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 138750902) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is 1-[4-[3-propoxypropyl(propyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[3-propoxypropyl(propyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 138750902 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-[4-[3-propoxypropyl(propyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CCCOCCCN(CCC)S(=O)(=O)c1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C22H32N4O4S/c1-3-13-26(14-6-16-30-15-4-2)31(28,29)21-10-8-20(9-11-21)25-22(27)24-18-19-7-5-12-23-17-19/h5,7-12,17H,3-4,6,13-16,18H2,1-2H3,(H2,24,25,27) |
| InChIKey | OLXXCFNSMMLLJD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|