C13H13N4O3- — CID 163182359
1-[4-[hydroxy(oxido)amino]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 163182359) has the molecular formula C13H13N4O3- and a molecular weight of 273.27 g/mol. Its IUPAC name is 1-[4-[hydroxy(oxido)amino]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[hydroxy(oxido)amino]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 163182359 |
| Molecular Formula | C13H13N4O3- |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-[4-[hydroxy(oxido)amino]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(N([O-])O)cc1 |
| InChI | InChI=1S/C13H13N4O3/c18-13(15-9-10-2-1-7-14-8-10)16-11-3-5-12(6-4-11)17(19)20/h1-8,19H,9H2,(H2,15,16,18)/q-1 |
| InChIKey | LMVKTZFEASNLET-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|