C14H15N5O2 — CID 91704077
N-[4-(pyridin-3-ylmethylcarbamoylamino)anilino]formamide (PubChem CID 91704077) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is N-[4-(pyridin-3-ylmethylcarbamoylamino)anilino]formamide.
| Compound Name | N-[4-(pyridin-3-ylmethylcarbamoylamino)anilino]formamide |
|---|---|
| PubChem CID | 91704077 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[4-(pyridin-3-ylmethylcarbamoylamino)anilino]formamide |
| SMILES | O=CNNc1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C14H15N5O2/c20-10-17-19-13-5-3-12(4-6-13)18-14(21)16-9-11-2-1-7-15-8-11/h1-8,10,19H,9H2,(H,17,20)(H2,16,18,21) |
| InChIKey | BNGBDLXEZOFHSN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|