C22H24N4O4S — CID 174859063
1-[4-(3,4-dimethylphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea;formamide (PubChem CID 174859063) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 1-[4-(3,4-dimethylphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea;formamide.
| Compound Name | 1-[4-(3,4-dimethylphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea;formamide |
|---|---|
| PubChem CID | 174859063 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-[4-(3,4-dimethylphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea;formamide |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(NC(=O)NCc3cccnc3)cc2)cc1C.NC=O |
| InChI | InChI=1S/C21H21N3O3S.CH3NO/c1-15-5-8-20(12-16(15)2)28(26,27)19-9-6-18(7-10-19)24-21(25)23-14-17-4-3-11-22-13-17;2-1-3/h3-13H,14H2,1-2H3,(H2,23,24,25);1H,(H2,2,3) |
| InChIKey | SCSAFFGENGQGGU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|