C21H19N5O3S — CID 66614235
1-[4-(1-methylindazol-5-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 66614235) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is 1-[4-(1-methylindazol-5-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-(1-methylindazol-5-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 66614235 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-[4-(1-methylindazol-5-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | Cn1ncc2cc(S(=O)(=O)c3ccc(NC(=O)NCc4cccnc4)cc3)ccc21 |
| InChI | InChI=1S/C21H19N5O3S/c1-26-20-9-8-19(11-16(20)14-24-26)30(28,29)18-6-4-17(5-7-18)25-21(27)23-13-15-3-2-10-22-12-15/h2-12,14H,13H2,1H3,(H2,23,25,27) |
| InChIKey | UPKFTQVHZBAAJE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |