C22H18FN5O3S — CID 66614230
1-[4-(3-fluoro-4-pyrazol-1-ylphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 66614230) has the molecular formula C22H18FN5O3S and a molecular weight of 451.48 g/mol. Its IUPAC name is 1-[4-(3-fluoro-4-pyrazol-1-ylphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-(3-fluoro-4-pyrazol-1-ylphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 66614230 |
| Molecular Formula | C22H18FN5O3S |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 1-[4-(3-fluoro-4-pyrazol-1-ylphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)c2ccc(-n3cccn3)c(F)c2)cc1 |
| InChI | InChI=1S/C22H18FN5O3S/c23-20-13-19(8-9-21(20)28-12-2-11-26-28)32(30,31)18-6-4-17(5-7-18)27-22(29)25-15-16-3-1-10-24-14-16/h1-14H,15H2,(H2,25,27,29) |
| InChIKey | SGTPBUDKJRBMSU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |