C24H26N4O4S — CID 66610835
N-(2-methylpropyl)-3-[4-(pyridin-3-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide (PubChem CID 66610835) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-(2-methylpropyl)-3-[4-(pyridin-3-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide.
| Compound Name | N-(2-methylpropyl)-3-[4-(pyridin-3-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 66610835 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-(2-methylpropyl)-3-[4-(pyridin-3-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide |
| SMILES | CC(C)CNC(=O)c1cccc(S(=O)(=O)c2ccc(NC(=O)NCc3cccnc3)cc2)c1 |
| InChI | InChI=1S/C24H26N4O4S/c1-17(2)14-26-23(29)19-6-3-7-22(13-19)33(31,32)21-10-8-20(9-11-21)28-24(30)27-16-18-5-4-12-25-15-18/h3-13,15,17H,14,16H2,1-2H3,(H,26,29)(H2,27,28,30) |
| InChIKey | XVQFUKIWYDPGEO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |