C25H26N4O4S — CID 56929064
N-cyclopentyl-3-[4-(pyridin-3-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide (PubChem CID 56929064) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is N-cyclopentyl-3-[4-(pyridin-3-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide.
| Compound Name | N-cyclopentyl-3-[4-(pyridin-3-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 56929064 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-cyclopentyl-3-[4-(pyridin-3-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)c2cccc(C(=O)NC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C25H26N4O4S/c30-24(28-20-7-1-2-8-20)19-6-3-9-23(15-19)34(32,33)22-12-10-21(11-13-22)29-25(31)27-17-18-5-4-14-26-16-18/h3-6,9-16,20H,1-2,7-8,17H2,(H,28,30)(H2,27,29,31) |
| InChIKey | WZQOWIDEKPESIP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |