C21H27N3O3S — CID 140618935
1-[4-(2,3-dimethylcyclohexyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 140618935) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylcyclohexyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-(2,3-dimethylcyclohexyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 140618935 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-[4-(2,3-dimethylcyclohexyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CC1CCCC(S(=O)(=O)c2ccc(NC(=O)NCc3cccnc3)cc2)C1C |
| InChI | InChI=1S/C21H27N3O3S/c1-15-5-3-7-20(16(15)2)28(26,27)19-10-8-18(9-11-19)24-21(25)23-14-17-6-4-12-22-13-17/h4,6,8-13,15-16,20H,3,5,7,14H2,1-2H3,(H2,23,24,25) |
| InChIKey | RYDDXKQONZEGFD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |