C19H21ClFN3O3S — CID 140619044
1-[4-(4-chloro-2-fluorocyclohexyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 140619044) has the molecular formula C19H21ClFN3O3S and a molecular weight of 425.91 g/mol. Its IUPAC name is 1-[4-(4-chloro-2-fluorocyclohexyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-(4-chloro-2-fluorocyclohexyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 140619044 |
| Molecular Formula | C19H21ClFN3O3S |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 1-[4-(4-chloro-2-fluorocyclohexyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)C2CCC(Cl)CC2F)cc1 |
| InChI | InChI=1S/C19H21ClFN3O3S/c20-14-3-8-18(17(21)10-14)28(26,27)16-6-4-15(5-7-16)24-19(25)23-12-13-2-1-9-22-11-13/h1-2,4-7,9,11,14,17-18H,3,8,10,12H2,(H2,23,24,25) |
| InChIKey | DCLMWKVGRUXHIA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|