C20H25FN4O4S — CID 140925948
1-[4-[(4-fluoro-3-methoxycyclohexyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 140925948) has the molecular formula C20H25FN4O4S and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[4-[(4-fluoro-3-methoxycyclohexyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[(4-fluoro-3-methoxycyclohexyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 140925948 |
| Molecular Formula | C20H25FN4O4S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-[4-[(4-fluoro-3-methoxycyclohexyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | COC1CC(NS(=O)(=O)c2ccc(NC(=O)NCc3cccnc3)cc2)CCC1F |
| InChI | InChI=1S/C20H25FN4O4S/c1-29-19-11-16(6-9-18(19)21)25-30(27,28)17-7-4-15(5-8-17)24-20(26)23-13-14-3-2-10-22-12-14/h2-5,7-8,10,12,16,18-19,25H,6,9,11,13H2,1H3,(H2,23,24,26) |
| InChIKey | YJLLTHFZGMJBBW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |