C26H25N3O4S — CID 70978965
N-cyclopentyl-3-[4-(3-pyridin-3-ylprop-2-enoylamino)phenyl]sulfonylbenzamide (PubChem CID 70978965) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-cyclopentyl-3-[4-(3-pyridin-3-ylprop-2-enoylamino)phenyl]sulfonylbenzamide.
| Compound Name | N-cyclopentyl-3-[4-(3-pyridin-3-ylprop-2-enoylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 70978965 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-cyclopentyl-3-[4-(3-pyridin-3-ylprop-2-enoylamino)phenyl]sulfonylbenzamide |
| SMILES | O=C(C=Cc1cccnc1)Nc1ccc(S(=O)(=O)c2cccc(C(=O)NC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C26H25N3O4S/c30-25(15-10-19-5-4-16-27-18-19)28-22-11-13-23(14-12-22)34(32,33)24-9-3-6-20(17-24)26(31)29-21-7-1-2-8-21/h3-6,9-18,21H,1-2,7-8H2,(H,28,30)(H,29,31) |
| InChIKey | STOXFAQLJDTOFZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|